From Wikipedia, the free encyclopedia
Pharmaceutical compound
Methylenedioxytrimethylamphetamine |
|
| Other names | 3,4-Methylenedioxy-N,N,N-trimethylamphetamine; MDTMA; Methylenedioxytrimethylamphetamine |
|---|
|
| Formula | C13H20NO2+ |
|---|
| Molar mass | 222.308 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O1COC2C=CC(=CC1=2)CC(C)[N+](C)(C)C
iodide: O1COC2C=CC(=CC1=2)CC(C)[N+](C)(C)C.[I-]
|
InChI=1S/C13H20NO2/c1-10(14(2,3)4)7-11-5-6-12-13(8-11)16-9-15-12/h5-6,8,10H,7,9H2,1-4H3/q+1 Key:WTWQKGODIISWAC-UHFFFAOYSA-N
|
3,4-Methylenedioxy-N,N,N-trimethylamphetamine (MDTMA) is a chemical compound of the amphetamine and methylenedioxyamphetamine families.[1] In contrast to 3,4-methylenedioxyamphetamine (MDA), 3,4-methylenedioxy-N-methylamphetamine (MDMA), and 3,4-methylenedioxy-N,N-dimethylamphetamine (MDDMA), MDTMA is completely inactive as a monoamine releasing agent.[1]
- ^ a b Sandtner W, Stockner T, Hasenhuetl PS, Partilla JS, Seddik A, Zhang YW, Cao J, Holy M, Steinkellner T, Rudnick G, Baumann MH, Ecker GF, Newman AH, Sitte HH (January 2016). "Binding Mode Selection Determines the Action of Ecstasy Homologs at Monoamine Transporters". Mol Pharmacol. 89 (1): 165–175. doi:10.1124/mol.115.101394. PMC 4702095. PMID 26519222.
|
|---|
| Phenethylamines | |
|---|
| Amphetamines | |
|---|
| Phentermines | |
|---|
| Cathinones | |
|---|
Phenylisobutylamines
(and further-extended) | |
|---|
Catecholamines
(and close relatives) | |
|---|
Cyclized
phenethylamines | | Phenylalkylpyrrolidines | |
|---|
2-Benzylpiperidines
(phenidates) | |
|---|
Phenylmorpholines
(phenmetrazines) | |
|---|
Phenyloxazolamines
(aminorexes) | |
|---|
Isoquinolines and
tetrahydroisoquinolines | |
|---|
| 2-Aminoindanes | |
|---|
| 2-Aminotetralins | |
|---|
| Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, OSU-6162 (PNU-96391), LPH-5, LPH-48)
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- Z3517967757
- ZC-B
|
|---|
|
|---|
| Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
|---|
|
